EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13NO |
| Net Charge | 0 |
| Average Mass | 187.242 |
| Monoisotopic Mass | 187.09971 |
| SMILES | C/C=C/C=C1\C=CC2=C1C(=O)CCN2 |
| InChI | InChI=1S/C12H13NO/c1-2-3-4-9-5-6-10-12(9)11(14)7-8-13-10/h2-6,13H,7-8H2,1H3/b3-2+,9-4+ |
| InChIKey | HKLWUXDZILHGOB-DSXPNFDZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. NEAU-Z4 (ncbitaxon:1218706) | - | PubMed (23421585) | |
| Streptomyces sp. MSC090213JE08 (ncbitaxon:1670457) | - | PubMed (26403163) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| streptazone E (CHEBI:156388) has role bacterial metabolite (CHEBI:76969) |
| streptazone E (CHEBI:156388) is a cyclic ketone (CHEBI:3992) |
| streptazone E (CHEBI:156388) is a cyclopentapyridine (CHEBI:37940) |
| streptazone E (CHEBI:156388) is a olefinic compound (CHEBI:78840) |
| streptazone E (CHEBI:156388) is a piperidine alkaloid (CHEBI:26147) |
| streptazone E (CHEBI:156388) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| (5E)-5-[(2E)-but-2-en-1-ylidene]-1,2,3,5-tetrahydro-4H-cyclopenta[b]pyridin-4-one |
| Synonym | Source |
|---|---|
| JBIR-70 | ChEBI |
| Citations |
|---|