EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12O4 |
| Net Charge | 0 |
| Average Mass | 184.191 |
| Monoisotopic Mass | 184.07356 |
| SMILES | [H][C@@]1(C2=C[C@H](O)[C@@H](C)OC2=O)O[C@@]1([H])C |
| InChI | InChI=1S/C9H12O4/c1-4-7(10)3-6(9(11)13-4)8-5(2)12-8/h3-5,7-8,10H,1-2H3/t4-,5+,7+,8-/m1/s1 |
| InChIKey | RCAULRNMJFUWRP-HETMPLHPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus melleus (ncbitaxon:138277) | - | DOI (10.1271/bbb.60.1375) | |
| Aspergillus ochraceus (ncbitaxon:40380) | |||
| - | DOI (10.1002/(SICI)1096-9063(199805)53:1<9::AID-PS745>3.0.CO;2-P) | ||
| - | PubMed (31284571) | Strain: LCJ11-102 | |
| Aspergillus westerdijkiae (ncbitaxon:357447) | - | PubMed (19589392 ) | |
| Exophiala sp. (ncbitaxon:1718875) | - | PubMed (18661951) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . mycotoxin Poisonous substance produced by fungi. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | nematicide A substance used to destroy pests of the phylum Nematoda (roundworms). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspyrone (CHEBI:156387) has role Aspergillus metabolite (CHEBI:76956) |
| aspyrone (CHEBI:156387) has role antibacterial agent (CHEBI:33282) |
| aspyrone (CHEBI:156387) has role mycotoxin (CHEBI:25442) |
| aspyrone (CHEBI:156387) has role nematicide (CHEBI:25491) |
| aspyrone (CHEBI:156387) is a 2-pyranones (CHEBI:75885) |
| aspyrone (CHEBI:156387) is a antibiotic antifungal agent (CHEBI:86478) |
| aspyrone (CHEBI:156387) is a epoxide (CHEBI:32955) |
| aspyrone (CHEBI:156387) is a polyketide (CHEBI:26188) |
| aspyrone (CHEBI:156387) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (5S,6R)-5-hydroxy-6-methyl-3-[(2S,3S)-3-methyloxiran-2-yl]-5,6-dihydro-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| CAS:17398-00-4 | ChemIDplus |
| Citations |
|---|