EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | CC1=C(O)C(=O)C(CO)=C(C)C1=O |
| InChI | InChI=1S/C9H10O4/c1-4-6(3-10)9(13)8(12)5(2)7(4)11/h10,12H,3H2,1-2H3 |
| InChIKey | ISBZQQHZWPNKOK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Shanorella spirotricha (ncbitaxon:113410) | - | DOI (10.1016/S0031-9422(00)85674-5) | |
| Chaetomium globosum CBS 148.51 (ncbitaxon:306901) | - | DOI (10.1039/C4MD00352G) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| shanorellin (CHEBI:156385) has role fungal metabolite (CHEBI:76946) |
| shanorellin (CHEBI:156385) is a diol (CHEBI:23824) |
| shanorellin (CHEBI:156385) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| shanorellin (CHEBI:156385) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| 2-hydroxy-6-(hydroxymethyl)-3,5-dimethylcyclohexa-2,5-diene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2,6-dimethyl-3-hydroxymethyl-5-hydroxy-1,4-benzoquinone | ChemIDplus |
| 2-hydroxy-6-hydroxymethyl-3,5-dimethyl-2,5-cyclohexadiene-1,4-dione | ChemIDplus |
| 2-hydroxy-6-hydroxymethyl-3,5-dimethyl-1,4-benzoquinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:22631-97-6 | ChemIDplus |
| Citations |
|---|