EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H43N3O6 |
| Net Charge | 0 |
| Average Mass | 565.711 |
| Monoisotopic Mass | 565.31519 |
| SMILES | C[C@@H]1C[C@H]1/C=C/[C@@H]1C[C@H]1[C@@H]1C[C@H]1[C@@H]1C[C@H]1[C@@H]1C[C@H]1/C=C/C=C/C(=O)NC[C@H]1O[C@@H](N2CCC(=O)NC2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H43N3O6/c1-16-10-17(16)6-7-19-12-21(19)23-14-25(23)24-13-22(24)20-11-18(20)4-2-3-5-27(36)33-15-26-29(38)30(39)31(41-26)35-9-8-28(37)34-32(35)40/h2-7,16-26,29-31,38-39H,8-15H2,1H3,(H,33,36)(H,34,37,40)/b4-2+,5-3+,7-6+/t16-,17-,18-,19-,20-,21-,22+,23+,24-,25-,26-,29-,30-,31-/m1/s1 |
| InChIKey | QOOORVUXEUQEKV-KNLYTHMISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptoverticillium fervens (ncbitaxon:66429) | cell suspension culture (BTO:0000221) | PubMed (2387768) | Strain: HP-891 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jawsamycin (CHEBI:156382) has role antifungal agent (CHEBI:35718) |
| jawsamycin (CHEBI:156382) has role bacterial metabolite (CHEBI:76969) |
| jawsamycin (CHEBI:156382) is a cyclopropanes (CHEBI:51454) |
| jawsamycin (CHEBI:156382) is a nucleoside analogue (CHEBI:60783) |
| jawsamycin (CHEBI:156382) is a olefinic compound (CHEBI:78840) |
| jawsamycin (CHEBI:156382) is a polyketide (CHEBI:26188) |
| jawsamycin (CHEBI:156382) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 5'-deoxy-5'-({(2E,4E)-5-[(1R,1'R,1''R,1'''R,2S,2'R,2''R,2'''S)-2'''-{(E)-2-[(1R,2R)-2-methylcyclopropyl]ethenyl}[1,1':2',1'':2'',1'''-quater(cyclopropan)]-2-yl]penta-2,4-dienoyl}amino)-5,6-dihydrouridine |
| Synonyms | Source |
|---|---|
| FR-900848 | ChemIDplus |
| FR900848 | SUBMITTER |
| FR 900848 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP0286330 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:120500-69-8 | ChemIDplus |
| Citations |
|---|