EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15NO3 |
| Net Charge | 0 |
| Average Mass | 161.201 |
| Monoisotopic Mass | 161.10519 |
| SMILES | C[N+](C)(C)[C@@H](CCO)C(=O)[O-] |
| InChI | InChI=1S/C7H15NO3/c1-8(2,3)6(4-5-9)7(10)11/h6,9H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | ILXTZIAPBIBHND-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichodesmium erythraeum (ncbitaxon:1206) | Whole Organism (NCIT:C13413) | PubMed (27799527) | Strain: Trichodesmium erythraeum strain IMS101 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| homoserine betaine (CHEBI:156381) is a L-α-amino acid (CHEBI:15705) |