EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O5 |
| Net Charge | 0 |
| Average Mass | 428.569 |
| Monoisotopic Mass | 428.25627 |
| SMILES | [H][C@@]12C[C@]3(C)C(=C)[C@@](C(=O)OC)(C(=O)[C@H](C)C3=O)[C@@]1(C)CC[C@]1([H])C(C)(C)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C26H36O5/c1-14-19(28)24(6)13-17-23(5)11-10-18(27)22(3,4)16(23)9-12-25(17,7)26(15(24)2,20(14)29)21(30)31-8/h14,16-17H,2,9-13H2,1,3-8H3/t14-,16-,17+,23-,24-,25+,26+/m1/s1 |
| InChIKey | GHUUUTISLYNCMY-SGMCZAPESA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protoaustinoid B (CHEBI:156380) is a carboxylic ester (CHEBI:33308) |
| protoaustinoid B (CHEBI:156380) is a cyclic terpene ketone (CHEBI:36130) |
| protoaustinoid B (CHEBI:156380) is a meroterpenoid (CHEBI:64419) |
| protoaustinoid B (CHEBI:156380) is a methyl ester (CHEBI:25248) |
| protoaustinoid B (CHEBI:156380) is a organic heterotetracyclic compound (CHEBI:38163) |
| protoaustinoid B (CHEBI:156380) is a terpene lactone (CHEBI:37668) |
| protoaustinoid B (CHEBI:156380) is a tertiary alcohol (CHEBI:26878) |
| UniProt Name | Source |
|---|---|
| protoaustinoid B | UniProt |
| Citations |
|---|