EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O7 |
| Net Charge | 0 |
| Average Mass | 428.481 |
| Monoisotopic Mass | 428.18350 |
| SMILES | [H][C@@]12OC(=O)[C@]3(C)C[C@@]4([H])[C@H](C)C5=CC(=O)OC(C)(C)C5=C[C@]5([H])OC(=C([C@]45C)[C@]13O)[C@H](C)O2 |
| InChI | InChI=1S/C24H28O7/c1-10-12-7-16(25)31-21(3,4)13(12)8-15-23(6)14(10)9-22(5)19(26)30-20-24(22,27)18(23)17(29-15)11(2)28-20/h7-8,10-11,14-15,20,27H,9H2,1-6H3/t10-,11+,14+,15+,20-,22+,23-,24+/m1/s1 |
| InChIKey | DIPUOHVSHWSKHT-QUUCWOAOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| paraherquonin (CHEBI:156379) is a cyclic terpene ketone (CHEBI:36130) |
| paraherquonin (CHEBI:156379) is a meroterpenoid (CHEBI:64419) |
| paraherquonin (CHEBI:156379) is a organic heteropolycyclic compound (CHEBI:38166) |
| paraherquonin (CHEBI:156379) is a terpene lactone (CHEBI:37668) |
| paraherquonin (CHEBI:156379) is a tertiary alcohol (CHEBI:26878) |