EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3S |
| Net Charge | 0 |
| Average Mass | 163.198 |
| Monoisotopic Mass | 163.03031 |
| SMILES | [NH3+][C@@H](CSCC=O)C(=O)[O-] |
| InChI | InChI=1S/C5H9NO3S/c6-4(5(8)9)3-10-2-1-7/h1,4H,2-3,6H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | DRZHETASIKUFOK-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(acetaldehyde)-L-cysteine zwitterion (CHEBI:156378) is a S-substituted L-cysteine (CHEBI:47910) |
| S-(acetaldehyde)-L-cysteine zwitterion (CHEBI:156378) is a zwitterion (CHEBI:27369) |
| UniProt Name | Source |
|---|---|
| S-(acetaldehyde)-L-cysteine | UniProt |