EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156376 - xenocyloin J
| Formula | C16H21NO2 |
| Net Charge | 0 |
| Average Mass | 259.349 |
| Monoisotopic Mass | 259.15723 |
| SMILES | CCC(C)C(=O)[C@@H](O)Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H21NO2/c1-4-11(2)16(19)15(18)9-12-10-17(3)14-8-6-5-7-13(12)14/h5-8,10-11,15,18H,4,9H2,1-3H3/t11?,15-/m0/s1 |
| InChIKey | IQGLSAITBRYLSO-MHTVFEQDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus bovienii (ncbitaxon:40576) | - | DOI (10.1177/1934578X1701201209) | Strain: SN52 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xenocyloin J (CHEBI:156376) has functional parent xenocyloin B (CHEBI:156367) |
| xenocyloin J (CHEBI:156376) is a methylindole (CHEBI:38460) |
| xenocyloin J (CHEBI:156376) is a secondary α-hydroxy ketone (CHEBI:2468) |
| xenocyloin J (CHEBI:156376) is a xenocyloin (CHEBI:156365) |