EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156368 - xenocyloin C
| Formula | C16H19NO3 |
| Net Charge | 0 |
| Average Mass | 273.332 |
| Monoisotopic Mass | 273.13649 |
| SMILES | CC(=O)O[C@@H](Cc1cnc2ccccc12)C(=O)C(C)C |
| InChI | InChI=1S/C16H19NO3/c1-10(2)16(19)15(20-11(3)18)8-12-9-17-14-7-5-4-6-13(12)14/h4-7,9-10,15,17H,8H2,1-3H3/t15-/m0/s1 |
| InChIKey | MNIVLQOKRHODTM-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus bovienii (ncbitaxon:40576) | - | PubMed (24488732) | Strain: SS-2004 |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xenocyloin C (CHEBI:156368) is a carboxylic ester (CHEBI:33308) |
| xenocyloin C (CHEBI:156368) is a xenocyloin (CHEBI:156365) |
| Incoming Relation(s) |
| xenocyloin H (CHEBI:156373) has functional parent xenocyloin C (CHEBI:156368) |