EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO2 |
| Net Charge | 0 |
| Average Mass | 231.295 |
| Monoisotopic Mass | 231.12593 |
| SMILES | CC(C)C(=O)[C@@H](O)Cc1cnc2ccccc12 |
| InChI | InChI=1S/C14H17NO2/c1-9(2)14(17)13(16)7-10-8-15-12-6-4-3-5-11(10)12/h3-6,8-9,13,15-16H,7H2,1-2H3/t13-/m0/s1 |
| InChIKey | AWOMKVFSCPBMJX-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus bovienii (ncbitaxon:40576) | - | DOI (10.1177/1934578X1701201209) |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xenocyloin A (CHEBI:156366) is a secondary α-hydroxy ketone (CHEBI:2468) |
| xenocyloin A (CHEBI:156366) is a xenocyloin (CHEBI:156365) |
| Incoming Relation(s) |
| xenocyloin G (CHEBI:156372) has functional parent xenocyloin A (CHEBI:156366) |
| IUPAC Name |
|---|
| 2-hydroxy-1-(1H-indol-3-yl)-4-methylpentan-3-one |