EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | C/C=C(\C)c1ccc(C)c(=O)o1 |
| InChI | InChI=1S/C10H12O2/c1-4-7(2)9-6-5-8(3)10(11)12-9/h4-6H,1-3H3/b7-4+ |
| InChIKey | FEEGMVBAILJAQO-QPJJXVBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium fujikuroi (ncbitaxon:5127) | - | PubMed (27856636) | |
| Fusarium graminearum (ncbitaxon:5518) | - | PubMed (31344458) | |
| Fusarium keratoplasticum (ncbitaxon:1328300) | - | PubMed (23396261) | |
| Fusarium petroliphilum (ncbitaxon:203961) | - | PubMed (23396261) |
| Roles Classification |
|---|
| Biological Roles: | mycotoxin Poisonous substance produced by fungi. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibepyrone A (CHEBI:156363) has role antibacterial agent (CHEBI:33282) |
| gibepyrone A (CHEBI:156363) has role mycotoxin (CHEBI:25442) |
| gibepyrone A (CHEBI:156363) is a 2-pyranones (CHEBI:75885) |
| gibepyrone A (CHEBI:156363) is a antibiotic antifungal agent (CHEBI:86478) |
| gibepyrone A (CHEBI:156363) is a olefinic compound (CHEBI:78840) |
| gibepyrone A (CHEBI:156363) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 6-[(2E)-but-2-en-2-yl]-3-methyl-2H-pyran-2-one |
| Synonym | Source |
|---|---|
| 6-[(2E)-2-buten-2-yl]-3-methyl-2H-pyran-2-one | IUPAC |
| Citations |
|---|