EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O2 |
| Net Charge | 0 |
| Average Mass | 164.204 |
| Monoisotopic Mass | 164.08373 |
| SMILES | C/C=C(\C)c1ccc(C)c(=O)o1 |
| InChI | InChI=1S/C10H12O2/c1-4-7(2)9-6-5-8(3)10(11)12-9/h4-6H,1-3H3/b7-4+ |
| InChIKey | FEEGMVBAILJAQO-QPJJXVBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium fujikuroi (ncbitaxon:5127) | - | PubMed (27856636) | |
| Fusarium graminearum (ncbitaxon:5518) | - | PubMed (31344458) | |
| Fusarium keratoplasticum (ncbitaxon:1328300) | - | PubMed (23396261) | |
| Fusarium petroliphilum (ncbitaxon:203961) | - | PubMed (23396261) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. mycotoxin Poisonous substance produced by fungi. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gibepyrone A (CHEBI:156363) has role antibacterial agent (CHEBI:33282) |
| gibepyrone A (CHEBI:156363) has role mycotoxin (CHEBI:25442) |
| gibepyrone A (CHEBI:156363) is a 2-pyranones (CHEBI:75885) |
| gibepyrone A (CHEBI:156363) is a antibiotic antifungal agent (CHEBI:86478) |
| gibepyrone A (CHEBI:156363) is a olefinic compound (CHEBI:78840) |
| gibepyrone A (CHEBI:156363) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 6-[(2E)-but-2-en-2-yl]-3-methyl-2H-pyran-2-one |
| Synonym | Source |
|---|---|
| 6-[(2E)-2-buten-2-yl]-3-methyl-2H-pyran-2-one | IUPAC |
| Citations |
|---|