EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O4 |
| Net Charge | 0 |
| Average Mass | 248.278 |
| Monoisotopic Mass | 248.10486 |
| SMILES | C/C=C/[C@H](O)[C@@H](O)/C=C/c1cccc(O)c1C=O |
| InChI | InChI=1S/C14H16O4/c1-2-4-13(17)14(18)8-7-10-5-3-6-12(16)11(10)9-15/h2-9,13-14,16-18H,1H3/b4-2+,8-7+/t13-,14-/m0/s1 |
| InChIKey | YUQDGJSYYKKISE-BUJAFJOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Magnaporthe oryzae (ncbitaxon:318829) | - | DOI (10.1271/bbb1961.55.2785) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-epi-pyriculol (CHEBI:156356) has role fungal metabolite (CHEBI:76946) |
| 10-epi-pyriculol (CHEBI:156356) is a benzaldehydes (CHEBI:22698) |
| 10-epi-pyriculol (CHEBI:156356) is a heptaketide (CHEBI:59872) |
| 10-epi-pyriculol (CHEBI:156356) is a homoallylic alcohol (CHEBI:134362) |
| 10-epi-pyriculol (CHEBI:156356) is a phenols (CHEBI:33853) |
| 10-epi-pyriculol (CHEBI:156356) is a secondary allylic alcohol (CHEBI:134396) |
| 10-epi-pyriculol (CHEBI:156356) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 2-[(1E,3S,4S,5E)-3,4-dihydroxyhepta-1,5-dienyl]-6-hydroxybenzaldehyde |
| Synonym | Source |
|---|---|
| epipyriculol | SUBMITTER |
| Citations |
|---|