EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O7 |
| Net Charge | 0 |
| Average Mass | 456.535 |
| Monoisotopic Mass | 456.21480 |
| SMILES | C=C1[C@@]2(C)CC3=C(C)[C@]4(C=CC(=O)OC4(C)C)CC[C@]3(C)[C@]1(C(=O)OC)C(=O)[C@@](C)(O)C2=O |
| InChI | InChI=1S/C26H32O7/c1-14-16-13-22(5)15(2)26(20(30)32-8,19(29)24(7,31)18(22)28)23(16,6)11-12-25(14)10-9-17(27)33-21(25,3)4/h9-10,31H,2,11-13H2,1,3-8H3/t22-,23+,24+,25+,26+/m1/s1 |
| InChIKey | HYHJAMQARBFCBV-RXBPMRIASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| preaustinoid A3 (CHEBI:156346) is a carboxylic ester (CHEBI:33308) |
| preaustinoid A3 (CHEBI:156346) is a meroterpenoid (CHEBI:64419) |
| preaustinoid A3 (CHEBI:156346) is a organic heterotetracyclic compound (CHEBI:38163) |
| preaustinoid A3 (CHEBI:156346) is a terpene lactone (CHEBI:37668) |
| preaustinoid A3 (CHEBI:156346) is a tertiary alcohol (CHEBI:26878) |
| UniProt Name | Source |
|---|---|
| preaustinoid A3 | UniProt |
| Citations |
|---|