EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H34O7 |
| Net Charge | 0 |
| Average Mass | 458.551 |
| Monoisotopic Mass | 458.23045 |
| SMILES | [H][C@@]12C[C@]3(C)C(=C)[C@@](C(=O)OC)(C(=O)[C@@](C)(O)C3=O)[C@@]1(C)CC[C@]1([H])C(C)(C)OC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C26H34O7/c1-14-23(5)13-16-22(4)11-10-17(27)33-21(2,3)15(22)9-12-24(16,6)26(14,20(30)32-8)19(29)25(7,31)18(23)28/h10-11,15-16,31H,1,9,12-13H2,2-8H3/t15-,16+,22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | SGTJQTPUMKGFFZ-RFMSQVAGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| preaustinoid A2 (CHEBI:156343) is a carboxylic ester (CHEBI:33308) |
| preaustinoid A2 (CHEBI:156343) is a cyclic terpene ketone (CHEBI:36130) |
| preaustinoid A2 (CHEBI:156343) is a meroterpenoid (CHEBI:64419) |
| preaustinoid A2 (CHEBI:156343) is a organic heterotetracyclic compound (CHEBI:38163) |
| preaustinoid A2 (CHEBI:156343) is a terpene lactone (CHEBI:37668) |
| preaustinoid A2 (CHEBI:156343) is a tertiary alcohol (CHEBI:26878) |
| preaustinoid A2 (CHEBI:156343) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| UniProt Name | Source |
|---|---|
| preaustinoid A2 | UniProt |
| Citations |
|---|