EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N3O13P3 |
| Net Charge | 0 |
| Average Mass | 465.141 |
| Monoisotopic Mass | 464.97395 |
| SMILES | Nc1ccn([C@@H]2OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)=C[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H14N3O13P3/c10-7-1-2-12(9(14)11-7)8-6(13)3-5(23-8)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-3,6,8,13H,4H2,(H,18,19)(H,20,21)(H2,10,11,14)(H2,15,16,17)/t6-,8-/m1/s1 |
| InChIKey | DGUQXKKDZHTKIE-HTRCEHHLSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a RNA-directed RNA polymerase (EC 2.7.7.48). antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) has functional parent 3'-deoxy-3',4'-didehydro-cytidine (CHEBI:156331) |
| 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) has role antimetabolite (CHEBI:35221) |
| 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) has role antiviral agent (CHEBI:22587) |
| 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) has role EC 2.7.7.48 (RNA-directed RNA polymerase) inhibitor (CHEBI:170010) |
| 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) is a organic triphosphate (CHEBI:62894) |
| 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) is a pyrimidone (CHEBI:38337) |
| 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) is conjugate acid of 3'-deoxy-3',4'-didehydro-CTP(4−) (CHEBI:166821) |
| Incoming Relation(s) |
| 3'-deoxy-3',4'-didehydro-CTP(4−) (CHEBI:166821) is conjugate base of 3'-deoxy-3',4'-didehydro-CTP (CHEBI:156336) |
| IUPAC Name |
|---|
| ({[({[(4R,5R)-5-(4-amino-2-oxo-1,2-dihydropyrimidin-1-yl)-4-hydroxy-4,5-dihydrofuran-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid |
| Synonyms | Source |
|---|---|
| [[(2R,3R)-2-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxy-2,3-dihydrofuran-5-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate | IUPAC |
| 3'-deoxy-3',4'-didehydro-cytidine-5'-triphosphate | ChEBI |
| 3'-deoxy-3',4'-didehydro-cytidine triphosphate | ChEBI |
| ddh-CTP | SUBMITTER |
| ddhCTP | ChEBI |
| ddhC-triphosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 107448068 | ChemSpider |
| Citations |
|---|