EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N2O4 |
| Net Charge | 0 |
| Average Mass | 462.590 |
| Monoisotopic Mass | 462.25186 |
| SMILES | [H]/C(CC/C(C)=C(\[H])CN1C(=O)c2cccc(O)c2Nc2c(O)cc(O)cc21)=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C28H34N2O4/c1-18(2)8-5-9-19(3)10-6-11-20(4)14-15-30-23-16-21(31)17-25(33)27(23)29-26-22(28(30)34)12-7-13-24(26)32/h7-8,10,12-14,16-17,29,31-33H,5-6,9,11,15H2,1-4H3/b19-10+,20-14+ |
| InChIKey | SALVHVNECODMJP-GNUCVDFRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora sp. RV115 (ncbitaxon:1448265) | - | PubMed (23170078) | |
| Micromonospora sp. (ncbitaxon:1876) | - | PubMed (18722414) | Strain: DJ115 |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | cathepsin L (EC 3.4.22.15) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor which interferes with the action of cathepsin L (EC 3.4.22.15). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diazepinomicin (CHEBI:156321) has part 2-trans,6-trans-farnesyl group (CHEBI:36535) |
| diazepinomicin (CHEBI:156321) has role antineoplastic agent (CHEBI:35610) |
| diazepinomicin (CHEBI:156321) has role antioxidant (CHEBI:22586) |
| diazepinomicin (CHEBI:156321) has role cathepsin L (EC 3.4.22.15) inhibitor (CHEBI:70821) |
| diazepinomicin (CHEBI:156321) is a dibenzodiazepine (CHEBI:64051) |
| diazepinomicin (CHEBI:156321) is a farnesane sesquiterpenoid (CHEBI:36757) |
| diazepinomicin (CHEBI:156321) is a olefinic compound (CHEBI:78840) |
| diazepinomicin (CHEBI:156321) is a secondary amine (CHEBI:32863) |
| diazepinomicin (CHEBI:156321) is a triol (CHEBI:27136) |
| Synonym | Source |
|---|---|
| 1,3,10-trihydroxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-11H-benzo[b][1,4]benzodiazepin-6-one | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| DB12420 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:733035-26-2 | SUBMITTER |
| Citations |
|---|