EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42O5 |
| Net Charge | 0 |
| Average Mass | 422.606 |
| Monoisotopic Mass | 422.30322 |
| SMILES | [H][C@@]12CC[C@H](C)[C@]13C(=C[C@@]1(C)CC[C@](C)(C[C@H](O)[C@H](O)[C@@](C)(O)CO)[C@@]21[H])[C@@H](C)C[C@H]3O |
| InChI | InChI=1S/C25H42O5/c1-14-10-19(28)25-15(2)6-7-16(25)20-22(3,11-17(14)25)8-9-23(20,4)12-18(27)21(29)24(5,30)13-26/h11,14-16,18-21,26-30H,6-10,12-13H2,1-5H3/t14-,15-,16-,18-,19+,20-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | KJHICOOTWQEHPN-DVMFOLSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium heterosporum (ncbitaxon:42747) | - | PubMed (10956462) | |
| Fusarium equiseti (ncbitaxon:61235) | - | DOI (10.1055/s-0035-1556229) | Strain: CNC-477 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mangicol A (CHEBI:156320) has role anti-inflammatory agent (CHEBI:67079) |
| mangicol A (CHEBI:156320) has role fungal metabolite (CHEBI:76946) |
| mangicol A (CHEBI:156320) has role marine metabolite (CHEBI:76507) |
| mangicol A (CHEBI:156320) is a carbopolycyclic compound (CHEBI:35294) |
| mangicol A (CHEBI:156320) is a pentol (CHEBI:37205) |
| mangicol A (CHEBI:156320) is a sesterterpenoid (CHEBI:26660) |
| IUPAC Name |
|---|
| 5-deoxy-5-[(3S,3aR,4R,6S,7aR,10R,10aR,10bS)-4-hydroxy-3,6,7a,10-tetramethyl-1,2,3,4,5,6,7a,8,9,10,10a,10b-dodecahydrocyclopenta[d]-s-indacen-10-yl]-2-C-methyl-L-arabinitol |
| Manual Xrefs | Databases |
|---|---|
| 8677759 | ChemSpider |
| Citations |
|---|