EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O3 |
| Net Charge | 0 |
| Average Mass | 428.657 |
| Monoisotopic Mass | 428.32905 |
| SMILES | CCC(C)/C=C(\C)CCCC(C)/C=C(C)/C=C(\C)CC(C)c1oc(=O)c(C)c(O)c1C |
| InChI | InChI=1S/C28H44O3/c1-10-18(2)14-19(3)12-11-13-20(4)15-21(5)16-22(6)17-23(7)27-24(8)26(29)25(9)28(30)31-27/h14-16,18,20,23,29H,10-13,17H2,1-9H3/b19-14+,21-15+,22-16+ |
| InChIKey | ZPFTUJZLXSKBKE-NZDFSFLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alternaria solani (ncbitaxon:48100) | - | PubMed (16356847) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alternapyrone (CHEBI:156318) has role fungal metabolite (CHEBI:76946) |
| alternapyrone (CHEBI:156318) is a 2-pyranones (CHEBI:75885) |
| alternapyrone (CHEBI:156318) is a decaketide (CHEBI:48128) |
| alternapyrone (CHEBI:156318) is a heteroaryl hydroxy compound (CHEBI:74818) |
| alternapyrone (CHEBI:156318) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 4-hydroxy-3,5-dimethyl-6-[(4E,6E,12E)-4,6,8,12,14-pentamethylhexadeca-4,6,12-trien-2-yl]-2H-pyran-2-one |
| Citations |
|---|