EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO10 |
| Net Charge | 0 |
| Average Mass | 541.553 |
| Monoisotopic Mass | 541.19480 |
| SMILES | [H][C@@]12CC(=O)O[C@]1([H])C1=C(C(=O)c3c(O)cccc3C1=O)[C@]1(O[C@H](C)CC(=O)[C@H]1OC1CCC(N(C)C)C(C)O1)O2 |
| InChI | InChI=1S/C28H31NO10/c1-12-10-17(31)27(37-20-9-8-15(29(3)4)13(2)35-20)28(38-12)23-22(26-18(39-28)11-19(32)36-26)24(33)14-6-5-7-16(30)21(14)25(23)34/h5-7,12-13,15,18,20,26-27,30H,8-11H2,1-4H3/t12-,13?,15?,18-,20?,26+,27-,28+/m1/s1 |
| InChIKey | DIESPMSGQPRWLG-VLKAYIDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lavendulae subsp. lavendulae (ncbitaxon:58340) | - | PubMed (23373695) | The strain was formerly known as Streptomyces aureofaciens CCM 3239. See PMID:29496832. Strain: CCM 3239 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| auricin (CHEBI:156301) has role bacterial metabolite (CHEBI:76969) |
| auricin (CHEBI:156301) is a 1,4-benzoquinones (CHEBI:132124) |
| auricin (CHEBI:156301) is a angucycline antibiotic (CHEBI:70737) |
| auricin (CHEBI:156301) is a benzoisochromanequinone (CHEBI:48129) |
| auricin (CHEBI:156301) is a organic heteropentacyclic compound (CHEBI:38164) |
| auricin (CHEBI:156301) is a oxanes (CHEBI:46942) |
| auricin (CHEBI:156301) is a phenols (CHEBI:33853) |
| auricin (CHEBI:156301) is a polyketide (CHEBI:26188) |
| auricin (CHEBI:156301) is a tertiary amino compound (CHEBI:50996) |
| auricin (CHEBI:156301) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (2'S,3'R,3aR,6'R,11bR)-3'-{[5-(dimethylamino)-6-methyltetrahydro-2H-pyran-2-yl]oxy}-7-hydroxy-6'-methyl-3a,5',6',11b-tetrahydrospiro[benzo[g]furo[3,2-c]isochromene-5,2'-pyran]-2,4',6,11(3H,3'H)-tetrone |
| Citations |
|---|