EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14O3 |
| Net Charge | 0 |
| Average Mass | 290.318 |
| Monoisotopic Mass | 290.09429 |
| SMILES | O=c1oc(/C=C/C=C/c2ccccc2)cc2cccc(O)c12 |
| InChI | InChI=1S/C19H14O3/c20-17-12-6-10-15-13-16(22-19(21)18(15)17)11-5-4-9-14-7-2-1-3-8-14/h1-13,20H/b9-4+,11-5+ |
| InChIKey | IFFMOWIJJAFQJN-HINBXAKRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fluoribacter dumoffii (ncbitaxon:463) | - | PubMed (15381093) | |
| Legionella parisiensis (ncbitaxon:45071) | - | PubMed (23821465) |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| legioliulin (CHEBI:156300) has role bacterial metabolite (CHEBI:76969) |
| legioliulin (CHEBI:156300) has role biological pigment (CHEBI:26130) |
| legioliulin (CHEBI:156300) is a benzenes (CHEBI:22712) |
| legioliulin (CHEBI:156300) is a isocoumarins (CHEBI:38758) |
| legioliulin (CHEBI:156300) is a olefinic compound (CHEBI:78840) |
| legioliulin (CHEBI:156300) is a phenols (CHEBI:33853) |
| legioliulin (CHEBI:156300) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| 8-hydroxy-3-[(1E,3E)-4-phenylbuta-1,3-dien-1-yl]-1H-isochromen-1-one |
| Synonyms | Source |
|---|---|
| 8-hydroxy-3-[(1E,3E)-4-phenyl-1,3-butadienyl]-1H-2-benzopyran-1-one | ChEBI |
| 8-hydroxy-3-[(1E,3E)-4-phenylbuta-1,3-dien-1-yl]-1H-2-benzopyran-1-one | IUPAC |
| Citations |
|---|