EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O5 |
| Net Charge | 0 |
| Average Mass | 378.509 |
| Monoisotopic Mass | 378.24062 |
| SMILES | CC1=C(C[C@H](O)/C=C\C=C\[C@@H](C)[C@@H](O)/C(C)=C/CC(C)C)OC(C)(O)C1=O |
| InChI | InChI=1S/C22H34O5/c1-14(2)11-12-16(4)20(24)15(3)9-7-8-10-18(23)13-19-17(5)21(25)22(6,26)27-19/h7-10,12,14-15,18,20,23-24,26H,11,13H2,1-6H3/b9-7+,10-8-,16-12+/t15-,18-,20-,22?/m1/s1 |
| InChIKey | AQQYZHDRTDSOER-LYKBUVKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stigmatella aurantiaca DW4/3-1 (ncbitaxon:378806) | - | PubMed (17919655) | |
| Archangium gephyra (ncbitaxon:48) | cell suspension culture (BTO:0000221) | PubMed (15981410) | Strain: Ar 10844 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurafuron A (CHEBI:156298) has role antifungal agent (CHEBI:35718) |
| aurafuron A (CHEBI:156298) has role bacterial metabolite (CHEBI:76969) |
| aurafuron A (CHEBI:156298) has role toxin (CHEBI:27026) |
| aurafuron A (CHEBI:156298) is a lactol (CHEBI:38131) |
| aurafuron A (CHEBI:156298) is a oxolanes (CHEBI:26912) |
| aurafuron A (CHEBI:156298) is a polyketide (CHEBI:26188) |
| aurafuron A (CHEBI:156298) is a secondary alcohol (CHEBI:35681) |
| aurafuron A (CHEBI:156298) is a secondary allylic alcohol (CHEBI:134396) |
| aurafuron A (CHEBI:156298) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| aurafuron A (CHEBI:156298) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 5-[(2S,3Z,5E,7R,8R,9E)-2,8-dihydroxy-7,9,12-trimethyltrideca-3,5,9-trien-1-yl]-2-hydroxy-2,4-dimethylfuran-3(2H)-one |
| Synonym | Source |
|---|---|
| (−)-aurafuron A | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 9948038 | ChemSpider |
| Citations |
|---|