EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16BrNO2 |
| Net Charge | 0 |
| Average Mass | 370.246 |
| Monoisotopic Mass | 369.03644 |
| SMILES | [H][C@@]12C=CC[C@]1([H])[C@H](c1cc3c(cc1Br)OCO3)Nc1ccccc12 |
| InChI | InChI=1S/C19H16BrNO2/c20-15-9-18-17(22-10-23-18)8-14(15)19-13-6-3-5-11(13)12-4-1-2-7-16(12)21-19/h1-5,7-9,11,13,19,21H,6,10H2/t11-,13-,19+/m0/s1 |
| InChIKey | YOLTZIVRJAPVPH-MJLGCCKJSA-N |
| Roles Classification |
|---|
| Biological Role: | G-protein-coupled receptor antagonist An antagonist at G-protein-coupled receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| G-15 (CHEBI:156295) has role antineoplastic agent (CHEBI:35610) |
| G-15 (CHEBI:156295) has role G-protein-coupled receptor antagonist (CHEBI:88295) |
| G-15 (CHEBI:156295) is a benzodioxole (CHEBI:38733) |
| G-15 (CHEBI:156295) is a organic heterotricyclic compound (CHEBI:26979) |
| G-15 (CHEBI:156295) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| (3aS,4R,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| Synonyms | Source |
|---|---|
| G 15 | ChEBI |
| G15 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1161002-05-6 | SUBMITTER |
| Citations |
|---|