EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19N3O2 |
| Net Charge | 0 |
| Average Mass | 333.391 |
| Monoisotopic Mass | 333.14773 |
| SMILES | [H][C@@]1(c2cnc3ccccc23)Nc2c(O)cccc2C(=O)N2CCC[C@]21[H] |
| InChI | InChI=1S/C20H19N3O2/c24-17-9-3-6-13-19(17)22-18(16-8-4-10-23(16)20(13)25)14-11-21-15-7-2-1-5-12(14)15/h1-3,5-7,9,11,16,18,21-22,24H,4,8,10H2/t16-,18-/m0/s1 |
| InChIKey | AJZNARCWDDMOPL-WMZOPIPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Klebsiella oxytoca (ncbitaxon:571) | - | PubMed (29389112) | |
| Klebsiella pneumoniae (ncbitaxon:573) | - | PubMed (11672297) | |
| Xenorhabdus eapokensis (ncbitaxon:1873482) | - | PubMed (29596433) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. microtubule-stabilising agent Any substance that interacts with tubulin to promote polymerisation of microtubules. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilivalline (CHEBI:156292) has role bacterial metabolite (CHEBI:76969) |
| tilivalline (CHEBI:156292) has role microtubule-stabilising agent (CHEBI:61950) |
| tilivalline (CHEBI:156292) has role toxin (CHEBI:27026) |
| tilivalline (CHEBI:156292) is a indole alkaloid (CHEBI:38958) |
| tilivalline (CHEBI:156292) is a indoles (CHEBI:24828) |
| tilivalline (CHEBI:156292) is a phenols (CHEBI:33853) |
| tilivalline (CHEBI:156292) is a pyrrolobenzodiazepine (CHEBI:131437) |
| IUPAC Name |
|---|
| (11S,11aS)-9-hydroxy-11-(1H-indol-3-yl)-1,2,3,10,11,11a-hexahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one |
| Synonyms | Source |
|---|---|
| (7S,8S)-11-hydroxy-8-(1H-indol-3-yl)-3,9-diazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one | ChEBI |
| epitilivalline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:80279-24-9 | ChemIDplus |
| Citations |
|---|