EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H10O7 |
| Net Charge | 0 |
| Average Mass | 350.282 |
| Monoisotopic Mass | 350.04265 |
| SMILES | Cc1c(O)c(=O)c2c(cc(O)c3c(=O)c4c(O)cccc4c(=O)c32)c1=O |
| InChI | InChI=1S/C19H10O7/c1-6-15(22)8-5-10(21)13-14(12(8)19(26)16(6)23)17(24)7-3-2-4-9(20)11(7)18(13)25/h2-5,20-21,23H,1H3 |
| InChIKey | LRVJUCBWMNTDLP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces antibioticus (ncbitaxon:1890) | - | PubMed (15368568) | Strain: ATCC 11891 |
| Streptomyces ansochromogenes (ncbitaxon:115647) | - | PubMed (28972184) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oviedomycin (CHEBI:156291) has role antineoplastic agent (CHEBI:35610) |
| oviedomycin (CHEBI:156291) has role bacterial metabolite (CHEBI:76969) |
| oviedomycin (CHEBI:156291) is a p-quinones (CHEBI:25830) |
| oviedomycin (CHEBI:156291) is a angucycline antibiotic (CHEBI:70737) |
| oviedomycin (CHEBI:156291) is a phenols (CHEBI:33853) |
| oviedomycin (CHEBI:156291) is a tetraphenes (CHEBI:51067) |
| IUPAC Name |
|---|
| 2,6,8-trihydroxy-3-methyltetraphene-1,4,7,12-tetrone |
| Synonyms | Source |
|---|---|
| 2,6,8-trihydroxy-3-methyl-benz[a]anthracene-1,4,7,12-tetrone | ChEBI |
| 2,6,8-trihydroxy-3-methyl-1,4,7,12-tetrahydrotetraphene-1,4,7,12-tetrone | ChEBI |
| 3-methyl-2,6,8-trihydroxybenzo[a]anthracene-1,4,7,12-tetrone | ChEBI |
| Citations |
|---|