EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O3 |
| Net Charge | 0 |
| Average Mass | 230.263 |
| Monoisotopic Mass | 230.09429 |
| SMILES | COC1=CC(=O)OC(/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C14H14O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3/b8-7+ |
| InChIKey | XEAQIWGXBXCYFX-BQYQJAHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper methysticum (ncbitaxon:130404) | root (BTO:0001188) | DOI (/10.1515/hsz-2019-0112) |
| Roles Classification |
|---|
| Biological Role: | glycine receptor antagonist An antagonist that blocks glycine receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DL-kavain (CHEBI:156288) has role glycine receptor antagonist (CHEBI:62754) |
| DL-kavain (CHEBI:156288) is a racemate (CHEBI:60911) |
| Synonyms | Source |
|---|---|
| (±)-kavain | LINCS |
| (±)-kawain | ChemIDplus |
| DL-Kavain | ChemIDplus |
| D,L-kawain | ChEBI |
| DL-Kawain | ChemIDplus |
| trans-5,6-Dihydro-4-methoxy-6-(2-phenylethenyl)-2H-pyran-2-one | SUBMITTER |
| Citations |
|---|