EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H27N7O2S |
| Net Charge | 0 |
| Average Mass | 513.627 |
| Monoisotopic Mass | 513.19469 |
| SMILES | Cc1cnc(CNC(=O)c2c(=O)c3ccc(N4CCCN(C)CC4)nc3n3c2sc2ccccc23)cn1 |
| InChI | InChI=1S/C27H27N7O2S/c1-17-14-29-18(15-28-17)16-30-26(36)23-24(35)19-8-9-22(33-11-5-10-32(2)12-13-33)31-25(19)34-20-6-3-4-7-21(20)37-27(23)34/h3-4,6-9,14-15H,5,10-13,16H2,1-2H3,(H,30,36) |
| InChIKey | XGPBJCHFROADCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CX-5461 (CHEBI:156287) has role antineoplastic agent (CHEBI:35610) |
| CX-5461 (CHEBI:156287) has role apoptosis inducer (CHEBI:68495) |
| CX-5461 (CHEBI:156287) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| CX-5461 (CHEBI:156287) is a diazepine (CHEBI:47918) |
| CX-5461 (CHEBI:156287) is a naphthyridine derivative (CHEBI:73539) |
| CX-5461 (CHEBI:156287) is a organic heterotetracyclic compound (CHEBI:38163) |
| CX-5461 (CHEBI:156287) is a pyrazines (CHEBI:38314) |
| CX-5461 (CHEBI:156287) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-(4-methyl-1,4-diazepan-1-yl)-N-[(5-methylpyrazin-2-yl)methyl]-5-oxo-5H-[1,3]benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxamide |
| Synonyms | Source |
|---|---|
| 2-(hexahydro-4-methyl-1H-1,4-diazepin-1-yl)-N-[(5-methyl-2-pyrazinyl)methyl]-5-oxo-5H-benzothiazolo[3,2-a][1,8]naphthyridine-6-carboxamide | ChEBI |
| CX 5461 | ChemIDplus |
| CX5461 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-6342 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1138549-36-6 | ChemIDplus |
| Citations |
|---|