EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H42O |
| Net Charge | 0 |
| Average Mass | 358.610 |
| Monoisotopic Mass | 358.32357 |
| SMILES | [H][C@@]12CCCC[C@]1(C)[C@@]1([H])CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(C)=O)[C@]1([H])CC2 |
| InChI | InChI=1S/C25H42O/c1-17(8-9-18(2)26)21-12-13-22-20-11-10-19-7-5-6-15-24(19,3)23(20)14-16-25(21,22)4/h17,19-23H,5-16H2,1-4H3/t17-,19+,20+,21-,22+,23+,24+,25-/m1/s1 |
| InChIKey | LMGRIFIYAJHRKP-NMQWMWRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26,27-dinor-5beta-cholestan-24-one (CHEBI:156279) is a bile acid (CHEBI:3098) |