EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156256 - 6-methyl-1-oxido-pyrazin-1-ium-2-carboxylic acid
| Formula | C6H6N2O3 |
| Net Charge | 0 |
| Average Mass | 154.125 |
| Monoisotopic Mass | 154.03784 |
| SMILES | Cc1cncc(C(=O)O)[n+]1[O-] |
| InChI | InChI=1S/C6H6N2O3/c1-4-2-7-3-5(6(9)10)8(4)11/h2-3H,1H3,(H,9,10) |
| InChIKey | DNRXJHATQULEHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methyl-1-oxido-pyrazin-1-ium-2-carboxylic acid (CHEBI:156256) is a pyrazinecarboxylic acid (CHEBI:48345) |