EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15624 - (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | [H]C(=O)[C@@H](O)[C@@H](O)CC(=O)C(=O)O |
| InChI | InChI=1S/C6H8O6/c7-2-5(10)3(8)1-4(9)6(11)12/h2-3,5,8,10H,1H2,(H,11,12)/t3-,5+/m0/s1 |
| InChIKey | IMUGYKFHMJLTOU-WVZVXSGGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid (CHEBI:15624) has functional parent hexanoic acid (CHEBI:30776) |
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid (CHEBI:15624) is a aldehyde (CHEBI:17478) |
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid (CHEBI:15624) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid (CHEBI:15624) is a dioxo monocarboxylic acid (CHEBI:35951) |
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid (CHEBI:15624) is conjugate acid of (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate (CHEBI:57442) |
| Incoming Relation(s) |
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate (CHEBI:57442) is conjugate base of (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid (CHEBI:15624) |
| IUPAC Name |
|---|
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoic acid |
| Synonyms | Source |
|---|---|
| (4S,5S)-4,5-Dihydroxy-2,6-dioxohexanoate | KEGG COMPOUND |
| (4S,5S)-4,5-dihydroxy-2,6-dioxohexanoate | ChEBI |
| 4-deoxy-L-erythro-hex-5-ulosuronic acid | ChEBI |