EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | O=C(O)C(=O)C[C@H](O)C(=O)CO |
| InChI | InChI=1S/C6H8O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,7-8H,1-2H2,(H,11,12)/t3-/m0/s1 |
| InChIKey | IBGYNIRCYXIAON-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-deoxy-D-glycero-hexo-2,5-diulosonic acid (CHEBI:15623) has functional parent hexanoic acid (CHEBI:30776) |
| 3-deoxy-D-glycero-hexo-2,5-diulosonic acid (CHEBI:15623) is a dioxo monocarboxylic acid (CHEBI:35951) |
| 3-deoxy-D-glycero-hexo-2,5-diulosonic acid (CHEBI:15623) is conjugate acid of 3-deoxy-D-glycero-hexo-2,5-diulosonate (CHEBI:29071) |
| Incoming Relation(s) |
| 3-deoxy-D-glycero-hexo-2,5-diulosonate (CHEBI:29071) is conjugate base of 3-deoxy-D-glycero-hexo-2,5-diulosonic acid (CHEBI:15623) |
| IUPAC Names |
|---|
| 3-deoxy-D-glycero-hexo-2,5-diulosonic acid |
| (4S)-4,6-dihydroxy-2,5-dioxohexanoic acid |
| Synonyms | Source |
|---|---|
| 2,5-Diketo-3-deoxy-D-gluconate | KEGG COMPOUND |
| 3-Deoxy-D-glycero-2,5-hexodiulosonate | KEGG COMPOUND |
| (4S)-4,6-Dihydroxy-2,5-dioxohexanoate | KEGG COMPOUND |