EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@]12CC[C@@H](C)[C@@]1([H])[C@]1([H])C(C)(C)[C@]1([H])CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O/c1-9-5-6-10-12(9)13-11(14(13,2)3)7-8-15(10,4)16/h9-13,16H,5-8H2,1-4H3/t9-,10+,11-,12-,13-,15+/m1/s1 |
| InChIKey | AYXPYQRXGNDJFU-IMNVLQEYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allophylus edulis (ncbitaxon:549436) | leaf (BTO:0000713) | DOI (10.1016/j.jep.2016.08.053) | |
| Inula britannica (ncbitaxon:119176) | - | PubMed (28278671) | |
| Melaleuca alternifolia (ncbitaxon:164405) | leaf (BTO:0000713) | Article (Essential oil of Melaleuca, terpene-4-ol (tea tree oil), ISO 4730, 2017, International Organization for Standardization, Geneva, Switzerland.) | |
| Melaleuca quinquenervia (ncbitaxon:164942) | leaf (BTO:0000713) | DOI (10.1016/S0305-1978(01)00112-0) | |
| Salvia officinalis (ncbitaxon:38868) | leaf (BTO:0000713) | PubMed (17402115) | |
| Stachys lavandulifolia (ncbitaxon:193339) | - | DOI (10.1016/j.indcrop.2017.12.025) | |
| Stachys pilifera (ncbitaxon:1541664) | - | PubMed (31651198) | |
| Stachys tmolea (ncbitaxon:876255) | - | PubMed (31516330) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antimycobacterial drug A drug used to treat or prevent infections caused by Mycobacteria, a genus of actinobacteria. Aerobic and nonmotile, members of the genus include the pathogens responsible for causing tuberculosis and leprosy. antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| viridiflorol (CHEBI:156228) has role anti-inflammatory agent (CHEBI:67079) |
| viridiflorol (CHEBI:156228) has role antifeedant (CHEBI:22583) |
| viridiflorol (CHEBI:156228) has role antimycobacterial drug (CHEBI:64912) |
| viridiflorol (CHEBI:156228) has role plant metabolite (CHEBI:76924) |
| viridiflorol (CHEBI:156228) has role volatile oil component (CHEBI:27311) |
| viridiflorol (CHEBI:156228) is a carbotricyclic compound (CHEBI:38032) |
| viridiflorol (CHEBI:156228) is a sesquiterpenoid (CHEBI:26658) |
| viridiflorol (CHEBI:156228) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1aR,4S,4aS,7R,7aS,7bS)-1,1,4,7-tetramethyldecahydro-1H-cyclopropa[e]azulen-4-ol |
| Synonyms | Source |
|---|---|
| d-viridiflorol | ChEBI |
| himbaccol | KNApSAcK |
| (+)-viridiflorol | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| viridiflorol | UniProt |
| Citations |
|---|