EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12C=C(C)CC[C@]1(O)[C@H](C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C15H26O/c1-10(2)13-6-5-12(4)15(16)8-7-11(3)9-14(13)15/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | COGPRPSWSKLKTF-QPSCCSFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pilgerodendron uviferum (ncbitaxon:103979) | - | PubMed (29861480) | |
| Croton hieronymi (IPNI:342670-1) | aerial part (BTO:0001658) | DOI (10.1016/S0031-9422(03)00202-4) | |
| Piper cubeba (ncbitaxon:405322) | - | DOI (10.1016/S0040-4039(00)91016-5) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-epicubenol (CHEBI:156227) has role plant metabolite (CHEBI:76924) |
| (−)-epicubenol (CHEBI:156227) has role volatile oil component (CHEBI:27311) |
| (−)-epicubenol (CHEBI:156227) is a octahydronaphthalenes (CHEBI:138397) |
| (−)-epicubenol (CHEBI:156227) is a sesquiterpenoid (CHEBI:26658) |
| (−)-epicubenol (CHEBI:156227) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,4R,4aS,8aR)-4,7-dimethyl-1-(propan-2-yl)-1,3,4,5,6,8a-hexahydronaphthalen-4a(2H)-ol |
| Synonyms | Source |
|---|---|
| (−)-epi-cubenol | ChEBI |
| epi-cubenol | ChemIDplus |
| epicubenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-epicubenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FDB016012 | FooDB |
| C00020145 | KNApSAcK |
| HMDB0037031 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:19912-67-5 | ChemIDplus |
| CAS:19912-67-5 | NIST Chemistry WebBook |
| Citations |
|---|