EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CCC(C)=CC1=C(C(C)C)CC[C@H]2C |
| InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,12,14H,5-8H2,1-4H3/t12-,14+/m1/s1 |
| InChIKey | FIAKMTRUEKZMNO-OCCSQVGLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupressus cashmeriana (ncbitaxon:187464) | leaf (BTO:0000713) | PubMed (26434142) | |
| Stachys viticina (ncbitaxon:1007651) | leaf (BTO:0000713) | PubMed (31661884) | |
| Tanacetum longifolium (ncbitaxon:1485332) | root (BTO:0001188) | PubMed (12453516) | |
| Vitis vinifera (ncbitaxon:29760) | - | PubMed (20707339) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epizonarene (CHEBI:156226) has role plant metabolite (CHEBI:76924) |
| epizonarene (CHEBI:156226) has role volatile oil component (CHEBI:27311) |
| epizonarene (CHEBI:156226) is a hexahydronaphthalenes (CHEBI:142348) |
| epizonarene (CHEBI:156226) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1R,8aS)-1,6-dimethyl-4-(propan-2-yl)-1,2,3,7,8,8a-hexahydronaphthalene |
| Synonyms | Source |
|---|---|
| 10-epizonarene | NIST Chemistry WebBook |
| (+)-epizonarene | KNApSAcK |
| UniProt Name | Source |
|---|---|
| epizonarene | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:41702-63-0 | NIST Chemistry WebBook |
| Citations |
|---|