EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@@]12C=C(C)CC[C@@]1(O)[C@H](C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C15H26O/c1-10(2)13-6-5-12(4)15(16)8-7-11(3)9-14(13)15/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | COGPRPSWSKLKTF-CBBWQLFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chamomilla recutita (IPNI:192583-1) | - | PubMed (11561445) | |
| Arisaema anurans (ncbitaxon:50230) | - | PubMed (30253851) | |
| Piper nigrum (ncbitaxon:13216) | leaf (BTO:0000713) | PubMed (31652848) | |
| Pilgerodendron uviferum (ncbitaxon:103979) | - | PubMed (29861480) | |
| Leptospermum scoparium (ncbitaxon:295139) | - | PubMed (32078653) | |
| Anthemis maritima (ncbitaxon:127979) | flower (BTO:0000469) | PubMed (27114258) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-cubenol (CHEBI:156224) has role acaricide (CHEBI:22153) |
| (−)-cubenol (CHEBI:156224) has role plant metabolite (CHEBI:76924) |
| (−)-cubenol (CHEBI:156224) has role volatile oil component (CHEBI:27311) |
| (−)-cubenol (CHEBI:156224) is a octahydronaphthalenes (CHEBI:138397) |
| (−)-cubenol (CHEBI:156224) is a sesquiterpenoid (CHEBI:26658) |
| (−)-cubenol (CHEBI:156224) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,4R,4aR,8aR)-4,7-dimethyl-1-(propan-2-yl)-1,3,4,5,6,8a-hexahydronaphthalen-4a(2H)-ol |
| Synonyms | Source |
|---|---|
| cubenol | ChemIDplus |
| 10βH-cadin-4-en-1-ol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| cubenol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0059841 | HMDB |
| C00033734 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:21284-22-0 | NIST Chemistry WebBook |
| CAS:21284-22-0 | ChemIDplus |
| Citations |
|---|