EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N4O4 |
| Net Charge | 0 |
| Average Mass | 336.392 |
| Monoisotopic Mass | 336.17976 |
| SMILES | O=C=NCCCCCCN1C(=O)N(CCCCCCN=C=O)C1=O |
| InChI | InChI=1S/C16H24N4O4/c21-13-17-9-5-1-3-7-11-19-15(23)20(16(19)24)12-8-4-2-6-10-18-14-22/h1-12H2 |
| InChIKey | ZIZJPRKHEXCVLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-bis(6-isocyanatohexyl)-1,3-diazetidine-2,4-dione (CHEBI:156221) is a diisocyanate (CHEBI:53213) |
| 1,3-bis(6-isocyanatohexyl)-1,3-diazetidine-2,4-dione (CHEBI:156221) is a uretdiones (CHEBI:156222) |
| IUPAC Name |
|---|
| 1,3-bis(6-isocyanatohexyl)-1,3-diazetidine-2,4-dione |
| Synonyms | Source |
|---|---|
| uretdione of hexamethylene diisocyanate | ChEBI |
| uretdione of HDI | ChEBI |
| Citations |
|---|