EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29ClO4 |
| Net Charge | 0 |
| Average Mass | 404.934 |
| Monoisotopic Mass | 404.17544 |
| SMILES | [H]C(=O)c1c(C)c(Cl)c(O)c(C/C=C(C)/C=C/[C@@]2(C)[C@H](C)CCC(=O)[C@@H]2C)c1O |
| InChI | InChI=1S/C23H29ClO4/c1-13(10-11-23(5)14(2)7-9-19(26)16(23)4)6-8-17-21(27)18(12-25)15(3)20(24)22(17)28/h6,10-12,14,16,27-28H,7-9H2,1-5H3/b11-10+,13-6+/t14-,16+,23+/m1/s1 |
| InChIKey | SETVRSKZJJWOPA-FLDGXQSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremonium egyptiacum (ncbitaxon:749675) | - | DOI (10.1073/pnas.1819254116) | |
| Ascochyta viciae (ncbitaxon:1677696) | - | PubMed (31028855) | |
| Nigrosabulum globosum (ncbitaxon:95328) | - | PubMed (11374942) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascochlorin (CHEBI:156219) has role angiogenesis inhibitor (CHEBI:48422) |
| ascochlorin (CHEBI:156219) has role antifungal agent (CHEBI:35718) |
| ascochlorin (CHEBI:156219) has role antineoplastic agent (CHEBI:35610) |
| ascochlorin (CHEBI:156219) has role antiprotozoal drug (CHEBI:35820) |
| ascochlorin (CHEBI:156219) has role fungal metabolite (CHEBI:76946) |
| ascochlorin (CHEBI:156219) is a cyclohexanones (CHEBI:23482) |
| ascochlorin (CHEBI:156219) is a dihydroxybenzaldehyde (CHEBI:50196) |
| ascochlorin (CHEBI:156219) is a meroterpenoid (CHEBI:64419) |
| ascochlorin (CHEBI:156219) is a monochlorobenzenes (CHEBI:83403) |
| ascochlorin (CHEBI:156219) is a olefinic compound (CHEBI:78840) |
| ascochlorin (CHEBI:156219) is a resorcinols (CHEBI:33572) |
| ascochlorin (CHEBI:156219) is a sesquiterpenoid (CHEBI:26658) |
| ascochlorin (CHEBI:156219) is conjugate acid of ascochlorin(1−) (CHEBI:146157) |
| Incoming Relation(s) |
| ascochlorin(1−) (CHEBI:146157) is conjugate base of ascochlorin (CHEBI:156219) |
| IUPAC Name |
|---|
| 3-chloro-4,6-dihydroxy-2-methyl-5-{(2E,4E)-3-methyl-5-[(1R,2R,6R)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dien-1-yl}benzaldehyde |
| Synonyms | Source |
|---|---|
| antibiotic LL-Z1272 gamma | ChemIDplus |
| antibiotic LL-Z1272γ | ChEBI |
| (−)-ascochlorin | ChEBI |
| ilicicolin D | ChemIDplus |
| LL-Z 1272 gamma | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:26166-39-2 | ChemIDplus |
| Citations |
|---|