EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18O2PS2 |
| Net Charge | -1 |
| Average Mass | 241.338 |
| Monoisotopic Mass | 241.04913 |
| SMILES | CCC(C)SP(=O)([O-])SC(C)CC |
| InChI | InChI=1S/C8H19O2PS2/c1-5-7(3)12-11(9,10)13-8(4)6-2/h7-8H,5-6H2,1-4H3,(H,9,10)/p-1 |
| InChIKey | CTSZRDMRQMEDBU-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Roles: | inorganic acid A Brønsted acid derived from one or more inorganic compounds. Inorganic acids (also known as mineral acids) form hydrons and conjugate base ions when dissolved in water. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(sec-butylsulfanyl)phosphinate (CHEBI:156217) is a dithiophosphoric acid (CHEBI:74944) |
| UniProt Name | Source |
|---|---|
| bis(sec-butylsulfanyl)phosphinate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-22352 | MetaCyc |