EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15N5O3S |
| Net Charge | 0 |
| Average Mass | 309.351 |
| Monoisotopic Mass | 309.08956 |
| SMILES | COCc1nc(N[C@H]2C=CS(=O)(=O)C2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C12H15N5O3S/c1-17-12-9(5-13-17)11(15-10(16-12)6-20-2)14-8-3-4-21(18,19)7-8/h3-5,8H,6-7H2,1-2H3,(H,14,15,16)/t8-/m0/s1 |
| InChIKey | JASUTVCHCBHRFH-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Biological Role: | MAIT cell agonist An agonist that selectively binds to and activates mucosal associated invariant T cells (MAIT cells). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-{[6-(methoxymethyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]amino}-2,3-dihydrothiophene 1,1-dioxide (CHEBI:156212) has role MAIT cell agonist (CHEBI:156211) |
| (S)-3-{[6-(methoxymethyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]amino}-2,3-dihydrothiophene 1,1-dioxide (CHEBI:156212) is a pyrazolopyrimidine (CHEBI:38669) |
| IUPAC Name |
|---|
| (3S)-3-{[6-(methoxymethyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl]amino}-2,3-dihydro-1H-1λ6-thiophene-1,1-dione |
| Synonyms | Source |
|---|---|
| DB08 | ChEBI |
| DB-8 | ChEBI |
| DB8 | ChEBI |
| (S)-3-((6-(methoxymethyl)-1-methyl-1H-pyrazolo[3,4-d]pyrimidin-4-yl)amino)-2,3-dihydrothiophene 1,1-dioxide | ChEBI |
| Citations |
|---|