EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O3 |
| Net Charge | 0 |
| Average Mass | 270.413 |
| Monoisotopic Mass | 270.21949 |
| SMILES | [H]C(CCCCCCCCO)=C([H])CCCCCC(=O)O |
| InChI | InChI=1S/C16H30O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h2,4,17H,1,3,5-15H2,(H,18,19) |
| InChIKey | MKIFOPBVDBXRTO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ambrettolic acid (CHEBI:156198) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| ambrettolic acid (CHEBI:156198) is a straight-chain fatty acid (CHEBI:59202) |
| ambrettolic acid (CHEBI:156198) is a ω-hydroxy-long-chain fatty acid (CHEBI:140997) |
| IUPAC Name |
|---|
| 16-hydroxyhexadec-7-enoic acid |
| Synonym | Source |
|---|---|
| 16-hydroxy-7-hexadecenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050106 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:506-14-9 | ChEBI |
| Citations |
|---|