EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | C/C1=C\CC/C(C)=C/C[C@](O)(C(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H34O/c1-16(2)20(21)14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,11-12,16,21H,6-7,9-10,13-15H2,1-5H3/b17-8+,18-12+,19-11+/t20-/m1/s1 |
| InChIKey | ZVWXZFYWLABNOW-UYSOGGTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boswellia serrata (ncbitaxon:613112) | - | PubMed (21157686) |
| Roles Classification |
|---|
| Biological Roles: | TRPV channel modulator Any transient receptor potential (TRP) channel modulator that modulates the TRPV channels (V = vanilloid). There is strong evidence that action at one or more of this class of proteins is responsible for the insecticidal action of pymetrozine, pyrifluquinazon, and afidopyropen. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serratol (CHEBI:156193) has functional parent cembrene C (CHEBI:82798) |
| serratol (CHEBI:156193) has role antiprotozoal drug (CHEBI:35820) |
| serratol (CHEBI:156193) has role plant metabolite (CHEBI:76924) |
| serratol (CHEBI:156193) has role TRPV channel modulator (CHEBI:142782) |
| serratol (CHEBI:156193) is a cembrane diterpenoid (CHEBI:60687) |
| serratol (CHEBI:156193) is a macrocycle (CHEBI:51026) |
| serratol (CHEBI:156193) is a olefinic compound (CHEBI:78840) |
| serratol (CHEBI:156193) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,3E,7E,11E)-4,8,12-trimethyl-1-(propan-2-yl)cyclotetradeca-3,7,11-trien-1-ol |
| Synonyms | Source |
|---|---|
| S(−)-cembra-3E,7E,11E-triene-1-ol | ChEBI |
| (−)-serratol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB019480 | FooDB |
| HMDB0039827 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:67814-27-1 | ChEBI |
| Citations |
|---|