EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156193 - serratol
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | C/C1=C\CC/C(C)=C/C[C@](O)(C(C)C)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H34O/c1-16(2)20(21)14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,11-12,16,21H,6-7,9-10,13-15H2,1-5H3/b17-8+,18-12+,19-11+/t20-/m1/s1 |
| InChIKey | ZVWXZFYWLABNOW-UYSOGGTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boswellia serrata (ncbitaxon:613112) | - | PubMed (21157686) |
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. TRPV channel modulator Any transient receptor potential (TRP) channel modulator that modulates the TRPV channels (V = vanilloid). There is strong evidence that action at one or more of this class of proteins is responsible for the insecticidal action of pymetrozine, pyrifluquinazon, and afidopyropen. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| serratol (CHEBI:156193) has functional parent cembrene C (CHEBI:82798) |
| serratol (CHEBI:156193) has role antiprotozoal drug (CHEBI:35820) |
| serratol (CHEBI:156193) has role plant metabolite (CHEBI:76924) |
| serratol (CHEBI:156193) has role TRPV channel modulator (CHEBI:142782) |
| serratol (CHEBI:156193) is a cembrane diterpenoid (CHEBI:60687) |
| serratol (CHEBI:156193) is a macrocycle (CHEBI:51026) |
| serratol (CHEBI:156193) is a olefinic compound (CHEBI:78840) |
| serratol (CHEBI:156193) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,3E,7E,11E)-4,8,12-trimethyl-1-(propan-2-yl)cyclotetradeca-3,7,11-trien-1-ol |
| Synonyms | Source |
|---|---|
| S(−)-cembra-3E,7E,11E-triene-1-ol | ChEBI |
| (−)-serratol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| FDB019480 | FooDB |
| HMDB0039827 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:67814-27-1 | ChEBI |
| Citations |
|---|