EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H40O3 |
| Net Charge | 0 |
| Average Mass | 364.570 |
| Monoisotopic Mass | 364.29775 |
| SMILES | [H][C@@]12C[C@H](O)[C@]3([H])C[C@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCO |
| InChI | InChI=1S/C23H40O3/c1-14(8-11-24)17-4-5-18-16-13-21(26)20-12-15(25)6-9-23(20,3)19(16)7-10-22(17,18)2/h14-21,24-26H,4-13H2,1-3H3/t14-,15-,16+,17-,18+,19+,20+,21+,22-,23-/m1/s1 |
| InChIKey | USQUBBGNLNAZCX-MAGGAUTPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-Nor-5-cholane-3,6,23-triol (CHEBI:156158) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (3R,5R,6S,8S,9S,10R,13R,14S,17R)-17-[(2R)-4-hydroxybutan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,6-diol |
| Manual Xrefs | Databases |
|---|---|
| LMST04060007 | LIPID MAPS |