EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29ClO5 |
| Net Charge | 0 |
| Average Mass | 420.933 |
| Monoisotopic Mass | 420.17035 |
| SMILES | [H]C(=O)c1c(C)c(Cl)c(O)c(C/C=C(\C)CC/C=C(\C)[C@]2([H])CC(=O)C(C)(C)O2)c1O |
| InChI | InChI=1S/C23H29ClO5/c1-13(7-6-8-14(2)18-11-19(26)23(4,5)29-18)9-10-16-21(27)17(12-25)15(3)20(24)22(16)28/h8-9,12,18,27-28H,6-7,10-11H2,1-5H3/b13-9+,14-8+/t18-/m0/s1 |
| InChIKey | VGYPZLGWVQQOST-JUERRSSISA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acremonium sclerotigenum (ncbitaxon:261921) | - | PubMed (27804952) | |
| Acremonium sp. (ncbitaxon:2046025) | - | DOI (10.1021/np8006793) | |
| Ascochyta viciae (ncbitaxon:1677696) | - | PubMed (4792115) | Isolated from the filter cake of the fermented broth. Strain: 34 |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ascofuranone (CHEBI:156148) has role angiogenesis inhibitor (CHEBI:48422) |
| ascofuranone (CHEBI:156148) has role antilipemic drug (CHEBI:35679) |
| ascofuranone (CHEBI:156148) has role antineoplastic agent (CHEBI:35610) |
| ascofuranone (CHEBI:156148) has role antiprotozoal drug (CHEBI:35820) |
| ascofuranone (CHEBI:156148) has role fungal metabolite (CHEBI:76946) |
| ascofuranone (CHEBI:156148) is a dihydroxybenzaldehyde (CHEBI:50196) |
| ascofuranone (CHEBI:156148) is a meroterpenoid (CHEBI:64419) |
| ascofuranone (CHEBI:156148) is a monochlorobenzenes (CHEBI:83403) |
| ascofuranone (CHEBI:156148) is a olefinic compound (CHEBI:78840) |
| ascofuranone (CHEBI:156148) is a resorcinols (CHEBI:33572) |
| ascofuranone (CHEBI:156148) is a sesquiterpenoid (CHEBI:26658) |
| ascofuranone (CHEBI:156148) is a tetrahydrofuranone (CHEBI:47016) |
| ascofuranone (CHEBI:156148) is conjugate acid of ascofuranone(1−) (CHEBI:146160) |
| Incoming Relation(s) |
| ascofuranone(1−) (CHEBI:146160) is conjugate base of ascofuranone (CHEBI:156148) |
| IUPAC Name |
|---|
| 3-chloro-5-{(2E,6E)-7-[(2S)-5,5-dimethyl-4-oxotetrahydrofuran-2-yl]-3-methylocta-2,6-dien-1-yl}-4,6-dihydroxy-2-methylbenzaldehyde |
| Synonyms | Source |
|---|---|
| ascofuranon | ChemIDplus |
| (−)-ascofuranone | ChEBI |
| (S)-ascofuranone | ChEBI |
| (S-(E,E))-3-chloro-4,6-dihydroxy-2-methyl-5-(3-methyl-7-(tetrahydro-5,5-dimethyl-4-oxo-2-furanyl)-2,6-octadienyl)-benzaldehyde | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Ascofuranone | Wikipedia |
| C00017973 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:38462-04-3 | ChemIDplus |
| Citations |
|---|