EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12OS |
| Net Charge | 0 |
| Average Mass | 120.217 |
| Monoisotopic Mass | 120.06089 |
| SMILES | CC(S)C(C)CO |
| InChI | InChI=1S/C5H12OS/c1-4(3-6)5(2)7/h4-7H,3H2,1-2H3 |
| InChIKey | RFMHFOPFUZZBAD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (17191898) | Identified in human axilla secretions. |
| Vitis vinifera (ncbitaxon:29760) | - | PubMed (17249683) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-3-sulfanylbutan-1-ol (CHEBI:156147) has role human metabolite (CHEBI:77746) |
| 2-methyl-3-sulfanylbutan-1-ol (CHEBI:156147) has role plant metabolite (CHEBI:76924) |
| 2-methyl-3-sulfanylbutan-1-ol (CHEBI:156147) is a alkanethiol (CHEBI:47908) |
| 2-methyl-3-sulfanylbutan-1-ol (CHEBI:156147) is a primary alcohol (CHEBI:15734) |
| 2-methyl-3-sulfanylbutan-1-ol (CHEBI:156147) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 2-methyl-3-sulfanylbutan-1-ol |
| Synonyms | Source |
|---|---|
| 2-methyl-3-mercapto-1-butanol | ChEBI |
| 3-mercapto-2-methyl-1-butanol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-methyl-3-sulfanylbutan-1-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21110 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:227456-33-9 | ChemIDplus |
| Citations |
|---|