EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O8 |
| Net Charge | 0 |
| Average Mass | 388.372 |
| Monoisotopic Mass | 388.11582 |
| SMILES | CC1(C)Oc2c(O)cc(C3CC(=O)c4c(O)cc(O)cc4O3)cc2C(O)C1O |
| InChI | InChI=1S/C20H20O8/c1-20(2)19(26)17(25)10-3-8(4-13(24)18(10)28-20)14-7-12(23)16-11(22)5-9(21)6-15(16)27-14/h3-6,14,17,19,21-22,24-26H,7H2,1-2H3 |
| InChIKey | UHWLHTOOVRRTDW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Erythrina sigmoidea (ncbitaxon:1977555) | bark (BTO:0001301) | DOI (10.1016/S0031-9422(00)95111-2) | Isolated from stem bark. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sigmoidin G (CHEBI:156111) has role plant metabolite (CHEBI:76924) |
| sigmoidin G (CHEBI:156111) is a pentahydroxyflavanone (CHEBI:38745) |
| sigmoidin G (CHEBI:156111) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 3',4',5,7,8'-pentahydroxy-2',2'-dimethyl-2,3,3',4'-tetrahydro-2'H,4H-[2,6'-bichromen]-4-one |
| Synonym | Source |
|---|---|
| 3',4',5,7,8'-pentahydroxy-2',2'-dimethyl-2,3,3',4'-tetrahydro-2'H,4H-[2,6'-bi-1-benzopyran]-4-one | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C00008516 | KNApSAcK |
| LMPK12140424 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:151590-50-0 | KNApSAcK |