EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H32Cl3NO |
| Net Charge | 0 |
| Average Mass | 528.951 |
| Monoisotopic Mass | 527.15495 |
| SMILES | CCCCN(CCCC)CC(O)c1cc(Cl)cc2c1-c1ccc(Cl)cc1/C2=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H32Cl3NO/c1-3-5-13-34(14-6-4-2)19-29(35)28-18-23(33)17-27-25(15-20-7-9-21(31)10-8-20)26-16-22(32)11-12-24(26)30(27)28/h7-12,15-18,29,35H,3-6,13-14,19H2,1-2H3/b25-15- |
| InChIKey | DYLGFOYVTXJFJP-MYYYXRDXSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lumefantrine (CHEBI:156095) has role antimalarial (CHEBI:38068) |
| lumefantrine (CHEBI:156095) is a fluorenes (CHEBI:24059) |
| lumefantrine (CHEBI:156095) is a monochlorobenzenes (CHEBI:83403) |
| lumefantrine (CHEBI:156095) is a secondary alcohol (CHEBI:35681) |
| lumefantrine (CHEBI:156095) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 2-(dibutylamino)-1-[(9Z)-2,7-dichloro-9-(4-chlorobenzylidene)-9H-fluoren-4-yl]ethanol |
| INN | Source |
|---|---|
| Lumefantrine | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (±)-2,7-Dichloro-9-((Z)-p-chlorobenzylidene)-α-((dibutylamino)methyl)fluorene-4-methanol | ChemIDplus |
| 2-Dibutylamino-1-{2,7-dichloro-9-[1-(4-chloro-phenyl)-meth-(Z)-ylidene]-9H-fluoren-4-yl}-ethanol | ChEMBL |
| 2-Dibutylamino-1-[2,7-dichloro-9-(4-chloro-benzylidene)-9H-fluoren-4-yl]-ethanol | ChEMBL |
| Benflumetol | ChemIDplus |
| dl-Benflumelol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1617 | DrugCentral |
| D03821 | KEGG DRUG |
| DB06708 | DrugBank |
| Lumefantrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8811003 | Beilstein |
| CAS:82186-77-4 | ChemIDplus |
| CAS:82186-77-4 | KEGG DRUG |
| Citations |
|---|