EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O2S |
| Net Charge | 0 |
| Average Mass | 162.254 |
| Monoisotopic Mass | 162.07145 |
| SMILES | CCCCOC(=O)CSC |
| InChI | InChI=1S/C7H14O2S/c1-3-4-5-9-7(8)6-10-2/h3-6H2,1-2H3 |
| InChIKey | QXJSYAFLDDZIQI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyl 2-(methylsulfanyl)acetate (CHEBI:156077) has functional parent (methylthio)acetic acid (CHEBI:47870) |
| butyl 2-(methylsulfanyl)acetate (CHEBI:156077) has role metabolite (CHEBI:25212) |
| butyl 2-(methylsulfanyl)acetate (CHEBI:156077) is a carboxylic ester (CHEBI:33308) |
| butyl 2-(methylsulfanyl)acetate (CHEBI:156077) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| butyl (methylsulfanyl)acetate |
| Synonyms | Source |
|---|---|
| butyl (methylthio)acetate | ChemIDplus |
| (methylthio)acetic acid butyl ester | ChemIDplus |
| n-butyl 2-methylthioacetate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| butyl 2-(methylsulfanyl)acetate | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:67746-25-2 | ChemIDplus |
| Citations |
|---|