EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O2 |
| Net Charge | 0 |
| Average Mass | 150.177 |
| Monoisotopic Mass | 150.06808 |
| SMILES | CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H10O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-7H,2H2,1H3 |
| InChIKey | MTZQAGJQAFMTAQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aquilaria sinensis (ncbitaxon:210372) | root (BTO:0001188) | PubMed (30154355) | |
| Elaeis guineensis (ncbitaxon:51953) | seed (BTO:0001226) | DOI (10.1016/j.lwt.2016.06.051) | Found in palm kernel oil. |
| Spondias pinnata (ncbitaxon:1592062) | fruit (BTO:0000486) | PubMed (31952118) | Isolated from fruit peel. |
| Vaccinium (ncbitaxon:13749) | - | PubMed (31802659) | Identified in in cranberry juices. |
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethyl benzoate (CHEBI:156074) has role flavouring agent (CHEBI:35617) |
| ethyl benzoate (CHEBI:156074) has role fragrance (CHEBI:48318) |
| ethyl benzoate (CHEBI:156074) has role volatile oil component (CHEBI:27311) |
| ethyl benzoate (CHEBI:156074) is a benzoate ester (CHEBI:36054) |
| ethyl benzoate (CHEBI:156074) is a ethyl ester (CHEBI:23990) |
| IUPAC Name |
|---|
| ethyl benzoate |
| Synonyms | Source |
|---|---|
| benzoic acid ethyl ester | ChEBI |
| Benzoic acid, ethyl ester | ChemIDplus |
| benzoic ether | ChemIDplus |
| benzoyl ethyl ether | ChemIDplus |
| ethyl benzenecarboxylate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| ethyl benzoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Ethyl_benzoate | Wikipedia |
| FDB012197 | FooDB |
| HMDB0033967 | HMDB |
| Citations |
|---|