EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16O2S |
| Net Charge | 0 |
| Average Mass | 176.281 |
| Monoisotopic Mass | 176.08710 |
| SMILES | CCCCOC(=O)CCSC |
| InChI | InChI=1S/C8H16O2S/c1-3-4-6-10-8(9)5-7-11-2/h3-7H2,1-2H3 |
| InChIKey | AOUVGXHIHWHVEM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyl 3-(methylsulfanyl)propanoate (CHEBI:156073) has functional parent 3-(methylthio)propionic acid (CHEBI:1438) |
| butyl 3-(methylsulfanyl)propanoate (CHEBI:156073) has role metabolite (CHEBI:25212) |
| butyl 3-(methylsulfanyl)propanoate (CHEBI:156073) is a carboxylic ester (CHEBI:33308) |
| butyl 3-(methylsulfanyl)propanoate (CHEBI:156073) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| butyl 3-(methylsulfanyl)propanoate |
| Synonyms | Source |
|---|---|
| 3-(methylthio)propanoic acid butyl ester | ChEBI |
| butyl 3-(methylthio)propanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| butyl 3-(methylsulfanyl)propanoate | UniProt |
| Citations |
|---|