EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:156070 - butyl benzoate
| Formula | C11H14O2 |
| Net Charge | 0 |
| Average Mass | 178.231 |
| Monoisotopic Mass | 178.09938 |
| SMILES | CCCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-2-3-9-13-11(12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChIKey | XSIFPSYPOVKYCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Applications: | antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butyl benzoate (CHEBI:156070) has role antimicrobial food preservative (CHEBI:65256) |
| butyl benzoate (CHEBI:156070) has role fragrance (CHEBI:48318) |
| butyl benzoate (CHEBI:156070) has role plant metabolite (CHEBI:76924) |
| butyl benzoate (CHEBI:156070) is a benzoate ester (CHEBI:36054) |
| IUPAC Name |
|---|
| butyl benzoate |
| Synonyms | Source |
|---|---|
| benzoic acid butyl ester | ChEBI |
| Benzoic acid, butyl ester | ChemIDplus |
| benzoic acid n-butyl ester | ChemIDplus |
| n-butyl benzoate | ChemIDplus |
| Brand Names | Source |
|---|---|
| Anthrapole AZ | ChemIDplus |
| Dai Cari XBN | ChemIDplus |
| UniProt Name | Source |
|---|---|
| butyl benzoate | UniProt |
| Citations |
|---|